C30H14N2O6 — CID 3949028
[8-(4-cyanobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 4-cyanobenzoate (PubChem CID 3949028) has the molecular formula C30H14N2O6 and a molecular weight of 498.45 g/mol. Its IUPAC name is [8-(4-cyanobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 4-cyanobenzoate.
| Compound Name | [8-(4-cyanobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 3949028 |
| Molecular Formula | C30H14N2O6 |
| Molecular Weight | 498.45 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | [8-(4-cyanobenzoyl)oxy-9,10-dioxoanthracen-1-yl] 4-cyanobenzoate |
| SMILES | N#Cc1ccc(C(=O)Oc2cccc3c2C(=O)c2c(OC(=O)c4ccc(C#N)cc4)cccc2C3=O)cc1 |
| InChI | InChI=1S/C30H14N2O6/c31-15-17-7-11-19(12-8-17)29(35)37-23-5-1-3-21-25(23)28(34)26-22(27(21)33)4-2-6-24(26)38-30(36)20-13-9-18(16-32)10-14-20/h1-14H |
| InChIKey | AKLZOYMOKPFRLQ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 134.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.45 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|