C19H15NO3 — CID 8910616
(4-methyl-8-oxo-6,7-dihydro-5H-naphthalen-1-yl) 4-cyanobenzoate (PubChem CID 8910616) has the molecular formula C19H15NO3 and a molecular weight of 305.33 g/mol. Its IUPAC name is (4-methyl-8-oxo-6,7-dihydro-5H-naphthalen-1-yl) 4-cyanobenzoate.
| Compound Name | (4-methyl-8-oxo-6,7-dihydro-5H-naphthalen-1-yl) 4-cyanobenzoate |
|---|---|
| PubChem CID | 8910616 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (4-methyl-8-oxo-6,7-dihydro-5H-naphthalen-1-yl) 4-cyanobenzoate |
| SMILES | Cc1ccc(OC(=O)c2ccc(C#N)cc2)c2c1CCCC2=O |
| InChI | InChI=1S/C19H15NO3/c1-12-5-10-17(18-15(12)3-2-4-16(18)21)23-19(22)14-8-6-13(11-20)7-9-14/h5-10H,2-4H2,1H3 |
| InChIKey | XCKRYTISIRKHHE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|