C35H21NO5 — CID 118029965
[1-[2-(4-hydroxybenzoyl)oxynaphthalen-1-yl]naphthalen-2-yl] 4-cyanobenzoate (PubChem CID 118029965) has the molecular formula C35H21NO5 and a molecular weight of 535.56 g/mol. Its IUPAC name is [1-[2-(4-hydroxybenzoyl)oxynaphthalen-1-yl]naphthalen-2-yl] 4-cyanobenzoate.
| Compound Name | [1-[2-(4-hydroxybenzoyl)oxynaphthalen-1-yl]naphthalen-2-yl] 4-cyanobenzoate |
|---|---|
| PubChem CID | 118029965 |
| Molecular Formula | C35H21NO5 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | [1-[2-(4-hydroxybenzoyl)oxynaphthalen-1-yl]naphthalen-2-yl] 4-cyanobenzoate |
| SMILES | N#Cc1ccc(C(=O)Oc2ccc3ccccc3c2-c2c(OC(=O)c3ccc(O)cc3)ccc3ccccc23)cc1 |
| InChI | InChI=1S/C35H21NO5/c36-21-22-9-11-25(12-10-22)34(38)40-30-19-15-23-5-1-3-7-28(23)32(30)33-29-8-4-2-6-24(29)16-20-31(33)41-35(39)26-13-17-27(37)18-14-26/h1-20,37H |
| InChIKey | ZDCAWDMTOGENJX-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 96.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|