C22H14N2O4S — CID 145123381
[2-(4-cyanophenyl)-4-methoxy-1,3-benzothiazol-7-yl] 4-hydroxybenzoate (PubChem CID 145123381) has the molecular formula C22H14N2O4S and a molecular weight of 402.43 g/mol. Its IUPAC name is [2-(4-cyanophenyl)-4-methoxy-1,3-benzothiazol-7-yl] 4-hydroxybenzoate.
| Compound Name | [2-(4-cyanophenyl)-4-methoxy-1,3-benzothiazol-7-yl] 4-hydroxybenzoate |
|---|---|
| PubChem CID | 145123381 |
| Molecular Formula | C22H14N2O4S |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | [2-(4-cyanophenyl)-4-methoxy-1,3-benzothiazol-7-yl] 4-hydroxybenzoate |
| SMILES | COc1ccc(OC(=O)c2ccc(O)cc2)c2sc(-c3ccc(C#N)cc3)nc12 |
| InChI | InChI=1S/C22H14N2O4S/c1-27-17-10-11-18(28-22(26)15-6-8-16(25)9-7-15)20-19(17)24-21(29-20)14-4-2-13(12-23)3-5-14/h2-11,25H,1H3 |
| InChIKey | ZCGAIHPKSRDFFR-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 92.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|