C45H44N2O11S — CID 142383938
[2-(4-cyanophenyl)-4-[4-[2-methoxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoyl]oxy-1,3-benzothiazol-7-yl] 4-propoxybenzoate;prop-2-enal (PubChem CID 142383938) has the molecular formula C45H44N2O11S and a molecular weight of 820.92 g/mol. Its IUPAC name is [2-(4-cyanophenyl)-4-[4-[2-methoxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoyl]oxy-1,3-benzothiazol-7-yl] 4-propoxybenzoate;prop-2-enal.
| Compound Name | [2-(4-cyanophenyl)-4-[4-[2-methoxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoyl]oxy-1,3-benzothiazol-7-yl] 4-propoxybenzoate;prop-2-enal |
|---|---|
| PubChem CID | 142383938 |
| Molecular Formula | C45H44N2O11S |
| Molecular Weight | 820.92 g/mol |
| Exact Mass | 820.27 |
| IUPAC Name | [2-(4-cyanophenyl)-4-[4-[2-methoxy-3-(4-prop-2-enoyloxybutoxy)propoxy]benzoyl]oxy-1,3-benzothiazol-7-yl] 4-propoxybenzoate;prop-2-enal |
| SMILES | C=CC(=O)OCCCCOCC(COc1ccc(C(=O)Oc2ccc(OC(=O)c3ccc(OCCC)cc3)c3sc(-c4ccc(C#N)cc4)nc23)cc1)OC.C=CC=O |
| InChI | InChI=1S/C42H40N2O10S.C3H4O/c1-4-22-50-32-16-12-31(13-17-32)42(47)54-36-21-20-35(38-39(36)55-40(44-38)29-10-8-28(25-43)9-11-29)53-41(46)30-14-18-33(19-15-30)52-27-34(48-3)26-49-23-6-7-24-51-37(45)5-2;1-2-3-4/h5,8-21,34H,2,4,6-7,22-24,26-27H2,1,3H3;2-3H,1H2 |
| InChIKey | GWJGEKVBNIFPPK-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 169.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.92 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|