C30H29NO5 — CID 158835098
[4-(4-cyanophenyl)phenyl] 3-methyl-4-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 158835098) has the molecular formula C30H29NO5 and a molecular weight of 483.56 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] 3-methyl-4-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-(4-cyanophenyl)phenyl] 3-methyl-4-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 158835098 |
| Molecular Formula | C30H29NO5 |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] 3-methyl-4-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1ccc(C(=O)Oc2ccc(-c3ccc(C#N)cc3)cc2)cc1C |
| InChI | InChI=1S/C30H29NO5/c1-3-29(32)35-19-7-5-4-6-18-34-28-17-14-26(20-22(28)2)30(33)36-27-15-12-25(13-16-27)24-10-8-23(21-31)9-11-24/h3,8-17,20H,1,4-7,18-19H2,2H3 |
| InChIKey | KRCIBQZRMFRINX-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|