C37H43NO6 — CID 122365441
[4-(4-cyanophenyl)phenyl] 4-octoxy-2-(6-prop-2-enoyloxyhexoxy)benzoate (PubChem CID 122365441) has the molecular formula C37H43NO6 and a molecular weight of 597.75 g/mol. Its IUPAC name is [4-(4-cyanophenyl)phenyl] 4-octoxy-2-(6-prop-2-enoyloxyhexoxy)benzoate.
| Compound Name | [4-(4-cyanophenyl)phenyl] 4-octoxy-2-(6-prop-2-enoyloxyhexoxy)benzoate |
|---|---|
| PubChem CID | 122365441 |
| Molecular Formula | C37H43NO6 |
| Molecular Weight | 597.75 g/mol |
| Exact Mass | 597.31 |
| IUPAC Name | [4-(4-cyanophenyl)phenyl] 4-octoxy-2-(6-prop-2-enoyloxyhexoxy)benzoate |
| SMILES | C=CC(=O)OCCCCCCOc1cc(OCCCCCCCC)ccc1C(=O)Oc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C37H43NO6/c1-3-5-6-7-8-11-24-41-33-22-23-34(35(27-33)42-25-12-9-10-13-26-43-36(39)4-2)37(40)44-32-20-18-31(19-21-32)30-16-14-29(28-38)15-17-30/h4,14-23,27H,2-3,5-13,24-26H2,1H3 |
| InChIKey | CDIHTGULQOXDPF-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.75 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|