C11H11NO4S — CID 67657854
(2,4-dimethoxy-1,3-benzothiazol-7-yl) acetate (PubChem CID 67657854) has the molecular formula C11H11NO4S and a molecular weight of 253.28 g/mol. Its IUPAC name is (2,4-dimethoxy-1,3-benzothiazol-7-yl) acetate.
| Compound Name | (2,4-dimethoxy-1,3-benzothiazol-7-yl) acetate |
|---|---|
| PubChem CID | 67657854 |
| Molecular Formula | C11H11NO4S |
| Molecular Weight | 253.28 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | (2,4-dimethoxy-1,3-benzothiazol-7-yl) acetate |
| SMILES | COc1nc2c(OC)ccc(OC(C)=O)c2s1 |
| InChI | InChI=1S/C11H11NO4S/c1-6(13)16-8-5-4-7(14-2)9-10(8)17-11(12-9)15-3/h4-5H,1-3H3 |
| InChIKey | SFUXXELTYSGXEQ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|