2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid

C9H8N2O3S — CID 84689044

IUPAC2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid
SMILESCOc1ccc(C(=O)O)c2nc(N)sc12
InChIInChI=1S/C9H8N2O3S/c1-14-5-3-2-4(8(12)13)6-7(5)15-9(10)11-6/h2-3H,1H3,(H2,10,11)(H,12,13)
InChIKeyCYGRRASFXNSQSJ-UHFFFAOYSA-N
MW224.24 g/mol
LogP1.59
Rot. Bonds2

About 2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid

2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid (PubChem CID 84689044) has the molecular formula C9H8N2O3S and a molecular weight of 224.24 g/mol. Its IUPAC name is 2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid.

Molecular Properties

Compound Name2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid
PubChem CID84689044
Molecular FormulaC9H8N2O3S
Molecular Weight224.24 g/mol
Exact Mass224.03
IUPAC Name2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid
SMILESCOc1ccc(C(=O)O)c2nc(N)sc12
InChIInChI=1S/C9H8N2O3S/c1-14-5-3-2-4(8(12)13)6-7(5)15-9(10)11-6/h2-3H,1H3,(H2,10,11)(H,12,13)
InChIKeyCYGRRASFXNSQSJ-UHFFFAOYSA-N
XLogP1.59
TPSA85.44 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.24
LogP ≤ 51.59
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid?
The IUPAC name of 2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid (CID 84689044) is 2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid.
What is the SMILES notation for 2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid?
The canonical SMILES for 2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid is COc1ccc(C(=O)O)c2nc(N)sc12.
What is the InChIKey of 2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid?
The InChIKey is CYGRRASFXNSQSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3S/c1-14-5-3-2-4(8(12)13)6-7(5)15-9(10)11-6/h2-3H,1H3,(H2,10,11)(H,12,13).
What are the key properties of 2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid?
2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid has a molecular weight of 224.24 g/mol, XLogP of 1.59, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-7-methoxy-1,3-benzothiazole-4-carboxylic acid is sourced from PubChem (CID 84689044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).