C10H10N3NaO2S2 — CID 157421038
sodium;4,7-dimethoxy-1,3-benzothiazol-2-amine;thiocyanate (PubChem CID 157421038) has the molecular formula C10H10N3NaO2S2 and a molecular weight of 291.33 g/mol. Its IUPAC name is sodium;4,7-dimethoxy-1,3-benzothiazol-2-amine;thiocyanate.
| Compound Name | sodium;4,7-dimethoxy-1,3-benzothiazol-2-amine;thiocyanate |
|---|---|
| PubChem CID | 157421038 |
| Molecular Formula | C10H10N3NaO2S2 |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.01 |
| IUPAC Name | sodium;4,7-dimethoxy-1,3-benzothiazol-2-amine;thiocyanate |
| SMILES | COc1ccc(OC)c2sc(N)nc12.N#C[S-].[Na+] |
| InChI | InChI=1S/C9H10N2O2S.CHNS.Na/c1-12-5-3-4-6(13-2)8-7(5)11-9(10)14-8;2-1-3;/h3-4H,1-2H3,(H2,10,11);3H;/q;;+1/p-1 |
| InChIKey | BPKHGOYHHSXRNO-UHFFFAOYSA-M |
| XLogP | -1.09 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | -1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|