C13H15N3O2S — CID 21303401
4-methoxy-7-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-1,3-benzothiazol-2-amine (PubChem CID 21303401) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 4-methoxy-7-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-1,3-benzothiazol-2-amine.
| Compound Name | 4-methoxy-7-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 21303401 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 4-methoxy-7-[(1S,4S)-2-oxa-5-azabicyclo[2.2.1]heptan-5-yl]-1,3-benzothiazol-2-amine |
| SMILES | COc1ccc(N2C[C@@H]3C[C@H]2CO3)c2sc(N)nc12 |
| InChI | InChI=1S/C13H15N3O2S/c1-17-10-3-2-9(12-11(10)15-13(14)19-12)16-5-8-4-7(16)6-18-8/h2-3,7-8H,4-6H2,1H3,(H2,14,15)/t7-,8-/m0/s1 |
| InChIKey | XLECRRJYNZASBV-YUMQZZPRSA-N |
| XLogP | 1.86 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|