C10H6N3O3PS2 — CID 141021820
[2-amino-7-methoxy-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate (PubChem CID 141021820) has the molecular formula C10H6N3O3PS2 and a molecular weight of 311.28 g/mol. Its IUPAC name is [2-amino-7-methoxy-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate.
| Compound Name | [2-amino-7-methoxy-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate |
|---|---|
| PubChem CID | 141021820 |
| Molecular Formula | C10H6N3O3PS2 |
| Molecular Weight | 311.28 g/mol |
| Exact Mass | 310.96 |
| IUPAC Name | [2-amino-7-methoxy-4-[(oxo-λ5-phosphanylidyne)methoxy]-1,3-benzothiazol-6-yl] thiocyanate |
| SMILES | COc1c(SC#N)cc(OC#P=O)c2nc(N)sc12 |
| InChI | InChI=1S/C10H6N3O3PS2/c1-15-8-6(18-3-11)2-5(16-4-17-14)7-9(8)19-10(12)13-7/h2H,1H3,(H2,12,13) |
| InChIKey | XEKRESQZFOCQAC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|