C9H9N3O4S — CID 96710251
6,7-dimethoxy-4-nitro-1,3-benzothiazol-2-amine (PubChem CID 96710251) has the molecular formula C9H9N3O4S and a molecular weight of 255.25 g/mol. Its IUPAC name is 6,7-dimethoxy-4-nitro-1,3-benzothiazol-2-amine.
| Compound Name | 6,7-dimethoxy-4-nitro-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 96710251 |
| Molecular Formula | C9H9N3O4S |
| Molecular Weight | 255.25 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 6,7-dimethoxy-4-nitro-1,3-benzothiazol-2-amine |
| SMILES | COc1cc([N+](=O)[O-])c2nc(N)sc2c1OC |
| InChI | InChI=1S/C9H9N3O4S/c1-15-5-3-4(12(13)14)6-8(7(5)16-2)17-9(10)11-6/h3H,1-2H3,(H2,10,11) |
| InChIKey | BTWVUQZXRJOHAJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.25 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|