C10H14N2O5 — CID 116987737
2-amino-1-(3,4-dimethoxy-5-nitrophenyl)ethanol (PubChem CID 116987737) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is 2-amino-1-(3,4-dimethoxy-5-nitrophenyl)ethanol.
| Compound Name | 2-amino-1-(3,4-dimethoxy-5-nitrophenyl)ethanol |
|---|---|
| PubChem CID | 116987737 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-amino-1-(3,4-dimethoxy-5-nitrophenyl)ethanol |
| SMILES | COc1cc(C(O)CN)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C10H14N2O5/c1-16-9-4-6(8(13)5-11)3-7(12(14)15)10(9)17-2/h3-4,8,13H,5,11H2,1-2H3 |
| InChIKey | QAXPBKSPJYXGSJ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|