C9H10INO4 — CID 22959553
5-(iodomethyl)-1,2-dimethoxy-3-nitrobenzene (PubChem CID 22959553) has the molecular formula C9H10INO4 and a molecular weight of 323.09 g/mol. Its IUPAC name is 5-(iodomethyl)-1,2-dimethoxy-3-nitrobenzene.
| Compound Name | 5-(iodomethyl)-1,2-dimethoxy-3-nitrobenzene |
|---|---|
| PubChem CID | 22959553 |
| Molecular Formula | C9H10INO4 |
| Molecular Weight | 323.09 g/mol |
| Exact Mass | 322.97 |
| IUPAC Name | 5-(iodomethyl)-1,2-dimethoxy-3-nitrobenzene |
| SMILES | COc1cc(CI)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C9H10INO4/c1-14-8-4-6(5-10)3-7(11(12)13)9(8)15-2/h3-4H,5H2,1-2H3 |
| InChIKey | LGNVGDUHHSLZRU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.09 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|