C8H8FNO4 — CID 118807824
5-fluoro-1,2-dimethoxy-3-nitrobenzene (PubChem CID 118807824) has the molecular formula C8H8FNO4 and a molecular weight of 201.15 g/mol. Its IUPAC name is 5-fluoro-1,2-dimethoxy-3-nitrobenzene.
| Compound Name | 5-fluoro-1,2-dimethoxy-3-nitrobenzene |
|---|---|
| PubChem CID | 118807824 |
| Molecular Formula | C8H8FNO4 |
| Molecular Weight | 201.15 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 5-fluoro-1,2-dimethoxy-3-nitrobenzene |
| SMILES | COc1cc(F)cc([N+](=O)[O-])c1OC |
| InChI | InChI=1S/C8H8FNO4/c1-13-7-4-5(9)3-6(10(11)12)8(7)14-2/h3-4H,1-2H3 |
| InChIKey | KYKIPRXEHKLVMG-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|