C12H15NO9P+ — CID 154463585
[[4-(2-ethoxy-2-oxoethoxy)-3-methoxy-5-nitrophenyl]-hydroxymethyl]-hydroxy-oxophosphanium (PubChem CID 154463585) has the molecular formula C12H15NO9P+ and a molecular weight of 348.22 g/mol. Its IUPAC name is [[4-(2-ethoxy-2-oxoethoxy)-3-methoxy-5-nitrophenyl]-hydroxymethyl]-hydroxy-oxophosphanium.
| Compound Name | [[4-(2-ethoxy-2-oxoethoxy)-3-methoxy-5-nitrophenyl]-hydroxymethyl]-hydroxy-oxophosphanium |
|---|---|
| PubChem CID | 154463585 |
| Molecular Formula | C12H15NO9P+ |
| Molecular Weight | 348.22 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | [[4-(2-ethoxy-2-oxoethoxy)-3-methoxy-5-nitrophenyl]-hydroxymethyl]-hydroxy-oxophosphanium |
| SMILES | CCOC(=O)COc1c(OC)cc(C(O)[P+](=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14NO9P/c1-3-21-10(14)6-22-11-8(13(16)17)4-7(5-9(11)20-2)12(15)23(18)19/h4-5,12,15H,3,6H2,1-2H3/p+1 |
| InChIKey | DTMZASFOYQKCTQ-UHFFFAOYSA-O |
| XLogP | 1.27 |
| TPSA | 145.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.22 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|