C11H12N2O7 — CID 139653226
5-amino-2-(2-ethoxy-2-oxoethoxy)-3-nitrobenzoic acid (PubChem CID 139653226) has the molecular formula C11H12N2O7 and a molecular weight of 284.22 g/mol. Its IUPAC name is 5-amino-2-(2-ethoxy-2-oxoethoxy)-3-nitrobenzoic acid.
| Compound Name | 5-amino-2-(2-ethoxy-2-oxoethoxy)-3-nitrobenzoic acid |
|---|---|
| PubChem CID | 139653226 |
| Molecular Formula | C11H12N2O7 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 5-amino-2-(2-ethoxy-2-oxoethoxy)-3-nitrobenzoic acid |
| SMILES | CCOC(=O)COc1c(C(=O)O)cc(N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N2O7/c1-2-19-9(14)5-20-10-7(11(15)16)3-6(12)4-8(10)13(17)18/h3-4H,2,5,12H2,1H3,(H,15,16) |
| InChIKey | ORJPDIBIHJOWIG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 141.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|