C16H15N3O2S — CID 87505168
7-nitro-4-(2,4,6-trimethylphenyl)-1,3-benzothiazol-2-amine (PubChem CID 87505168) has the molecular formula C16H15N3O2S and a molecular weight of 313.38 g/mol. Its IUPAC name is 7-nitro-4-(2,4,6-trimethylphenyl)-1,3-benzothiazol-2-amine.
| Compound Name | 7-nitro-4-(2,4,6-trimethylphenyl)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 87505168 |
| Molecular Formula | C16H15N3O2S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | 7-nitro-4-(2,4,6-trimethylphenyl)-1,3-benzothiazol-2-amine |
| SMILES | Cc1cc(C)c(-c2ccc([N+](=O)[O-])c3sc(N)nc23)c(C)c1 |
| InChI | InChI=1S/C16H15N3O2S/c1-8-6-9(2)13(10(3)7-8)11-4-5-12(19(20)21)15-14(11)18-16(17)22-15/h4-7H,1-3H3,(H2,17,18) |
| InChIKey | NBQBOQNFXAEFDB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 82.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|