C19H18N2O3 — CID 71497917
5-(2-methyl-6-nitrophenyl)-3-(2,4,6-trimethylphenyl)-1,2-oxazole (PubChem CID 71497917) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 5-(2-methyl-6-nitrophenyl)-3-(2,4,6-trimethylphenyl)-1,2-oxazole.
| Compound Name | 5-(2-methyl-6-nitrophenyl)-3-(2,4,6-trimethylphenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 71497917 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 5-(2-methyl-6-nitrophenyl)-3-(2,4,6-trimethylphenyl)-1,2-oxazole |
| SMILES | Cc1cc(C)c(-c2cc(-c3c(C)cccc3[N+](=O)[O-])on2)c(C)c1 |
| InChI | InChI=1S/C19H18N2O3/c1-11-8-13(3)18(14(4)9-11)15-10-17(24-20-15)19-12(2)6-5-7-16(19)21(22)23/h5-10H,1-4H3 |
| InChIKey | RUBZTAQIPNBBOL-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 69.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|