C20H19N3O3S — CID 8914285
2-methyl-3-nitro-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 8914285) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is 2-methyl-3-nitro-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 2-methyl-3-nitro-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 8914285 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-methyl-3-nitro-N-[4-(2,4,6-trimethylphenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | Cc1cc(C)c(-c2csc(NC(=O)c3cccc([N+](=O)[O-])c3C)n2)c(C)c1 |
| InChI | InChI=1S/C20H19N3O3S/c1-11-8-12(2)18(13(3)9-11)16-10-27-20(21-16)22-19(24)15-6-5-7-17(14(15)4)23(25)26/h5-10H,1-4H3,(H,21,22,24) |
| InChIKey | FRBKWLJOMPRFBA-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|