C9H8N4O2S — CID 3832219
5-(3-methyl-4-nitrophenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 3832219) has the molecular formula C9H8N4O2S and a molecular weight of 236.26 g/mol. Its IUPAC name is 5-(3-methyl-4-nitrophenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(3-methyl-4-nitrophenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 3832219 |
| Molecular Formula | C9H8N4O2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 5-(3-methyl-4-nitrophenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1cc(-c2nnc(N)s2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H8N4O2S/c1-5-4-6(2-3-7(5)13(14)15)8-11-12-9(10)16-8/h2-4H,1H3,(H2,10,12) |
| InChIKey | SMCXICRSFWNKCF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|