C12H15N5O2 — CID 112593605
[4-ethyl-5-(3-methyl-4-nitrophenyl)-1,2,4-triazol-3-yl]methanamine (PubChem CID 112593605) has the molecular formula C12H15N5O2 and a molecular weight of 261.29 g/mol. Its IUPAC name is [4-ethyl-5-(3-methyl-4-nitrophenyl)-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [4-ethyl-5-(3-methyl-4-nitrophenyl)-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 112593605 |
| Molecular Formula | C12H15N5O2 |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | [4-ethyl-5-(3-methyl-4-nitrophenyl)-1,2,4-triazol-3-yl]methanamine |
| SMILES | CCn1c(CN)nnc1-c1ccc([N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C12H15N5O2/c1-3-16-11(7-13)14-15-12(16)9-4-5-10(17(18)19)8(2)6-9/h4-6H,3,7,13H2,1-2H3 |
| InChIKey | DCHRWBPWZJELKQ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|