C11H12FN5O2 — CID 112593504
[4-ethyl-5-(5-fluoro-2-nitrophenyl)-1,2,4-triazol-3-yl]methanamine (PubChem CID 112593504) has the molecular formula C11H12FN5O2 and a molecular weight of 265.25 g/mol. Its IUPAC name is [4-ethyl-5-(5-fluoro-2-nitrophenyl)-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [4-ethyl-5-(5-fluoro-2-nitrophenyl)-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 112593504 |
| Molecular Formula | C11H12FN5O2 |
| Molecular Weight | 265.25 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | [4-ethyl-5-(5-fluoro-2-nitrophenyl)-1,2,4-triazol-3-yl]methanamine |
| SMILES | CCn1c(CN)nnc1-c1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12FN5O2/c1-2-16-10(6-13)14-15-11(16)8-5-7(12)3-4-9(8)17(18)19/h3-5H,2,6,13H2,1H3 |
| InChIKey | LABHZDYLYFVCDZ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|