C11H12FN5O2S — CID 63315622
[5-[(5-fluoro-2-nitrophenyl)methylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanamine (PubChem CID 63315622) has the molecular formula C11H12FN5O2S and a molecular weight of 297.31 g/mol. Its IUPAC name is [5-[(5-fluoro-2-nitrophenyl)methylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [5-[(5-fluoro-2-nitrophenyl)methylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 63315622 |
| Molecular Formula | C11H12FN5O2S |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | [5-[(5-fluoro-2-nitrophenyl)methylsulfanyl]-4-methyl-1,2,4-triazol-3-yl]methanamine |
| SMILES | Cn1c(CN)nnc1SCc1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12FN5O2S/c1-16-10(5-13)14-15-11(16)20-6-7-4-8(12)2-3-9(7)17(18)19/h2-4H,5-6,13H2,1H3 |
| InChIKey | KSGRKTOOLRNRQY-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|