C9H6IN3O3S — CID 63383509
2-iodo-5-(4-methoxy-3-nitrophenyl)-1,3,4-thiadiazole (PubChem CID 63383509) has the molecular formula C9H6IN3O3S and a molecular weight of 363.14 g/mol. Its IUPAC name is 2-iodo-5-(4-methoxy-3-nitrophenyl)-1,3,4-thiadiazole.
| Compound Name | 2-iodo-5-(4-methoxy-3-nitrophenyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 63383509 |
| Molecular Formula | C9H6IN3O3S |
| Molecular Weight | 363.14 g/mol |
| Exact Mass | 362.92 |
| IUPAC Name | 2-iodo-5-(4-methoxy-3-nitrophenyl)-1,3,4-thiadiazole |
| SMILES | COc1ccc(-c2nnc(I)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H6IN3O3S/c1-16-7-3-2-5(4-6(7)13(14)15)8-11-12-9(10)17-8/h2-4H,1H3 |
| InChIKey | VZLNAPSUUPLJMK-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 78.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.14 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|