C9H8IN3OS — CID 130052804
5-(3-iodo-4-methoxyphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 130052804) has the molecular formula C9H8IN3OS and a molecular weight of 333.15 g/mol. Its IUPAC name is 5-(3-iodo-4-methoxyphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(3-iodo-4-methoxyphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 130052804 |
| Molecular Formula | C9H8IN3OS |
| Molecular Weight | 333.15 g/mol |
| Exact Mass | 332.94 |
| IUPAC Name | 5-(3-iodo-4-methoxyphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | COc1ccc(-c2nnc(N)s2)cc1I |
| InChI | InChI=1S/C9H8IN3OS/c1-14-7-3-2-5(4-6(7)10)8-12-13-9(11)15-8/h2-4H,1H3,(H2,11,13) |
| InChIKey | DFTLSWZUSMSKHE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.15 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|