C10H7IN4S — CID 148874730
5-(3-iodo-1H-indol-5-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 148874730) has the molecular formula C10H7IN4S and a molecular weight of 342.17 g/mol. Its IUPAC name is 5-(3-iodo-1H-indol-5-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(3-iodo-1H-indol-5-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 148874730 |
| Molecular Formula | C10H7IN4S |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 341.94 |
| IUPAC Name | 5-(3-iodo-1H-indol-5-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccc3[nH]cc(I)c3c2)s1 |
| InChI | InChI=1S/C10H7IN4S/c11-7-4-13-8-2-1-5(3-6(7)8)9-14-15-10(12)16-9/h1-4,13H,(H2,12,15) |
| InChIKey | PBWOFVGSHDUPKX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|