C11H13N3OS — CID 67236110
5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 67236110) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 67236110 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 5-(4-methoxy-3,5-dimethylphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | COc1c(C)cc(-c2nnc(N)s2)cc1C |
| InChI | InChI=1S/C11H13N3OS/c1-6-4-8(5-7(2)9(6)15-3)10-13-14-11(12)16-10/h4-5H,1-3H3,(H2,12,14) |
| InChIKey | VENOFUHFXRICIW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |