C16H15N3OS — CID 22713200
5-[4-(4-ethoxyphenyl)phenyl]-1,3,4-thiadiazol-2-amine (PubChem CID 22713200) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 5-[4-(4-ethoxyphenyl)phenyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[4-(4-ethoxyphenyl)phenyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 22713200 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 5-[4-(4-ethoxyphenyl)phenyl]-1,3,4-thiadiazol-2-amine |
| SMILES | CCOc1ccc(-c2ccc(-c3nnc(N)s3)cc2)cc1 |
| InChI | InChI=1S/C16H15N3OS/c1-2-20-14-9-7-12(8-10-14)11-3-5-13(6-4-11)15-18-19-16(17)21-15/h3-10H,2H2,1H3,(H2,17,19) |
| InChIKey | KJMBZFMTFIHGPZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |