C11H12N6OS — CID 59154562
5-[4-(3-azidopropoxy)phenyl]-1,3,4-thiadiazol-2-amine (PubChem CID 59154562) has the molecular formula C11H12N6OS and a molecular weight of 276.33 g/mol. Its IUPAC name is 5-[4-(3-azidopropoxy)phenyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[4-(3-azidopropoxy)phenyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 59154562 |
| Molecular Formula | C11H12N6OS |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 5-[4-(3-azidopropoxy)phenyl]-1,3,4-thiadiazol-2-amine |
| SMILES | [N-]=[N+]=NCCCOc1ccc(-c2nnc(N)s2)cc1 |
| InChI | InChI=1S/C11H12N6OS/c12-11-16-15-10(19-11)8-2-4-9(5-3-8)18-7-1-6-14-17-13/h2-5H,1,6-7H2,(H2,12,16) |
| InChIKey | FSOWIXOLIUEFLW-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 109.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|