C11H11N3OS — CID 114520379
5-(4-cyclopropyloxyphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 114520379) has the molecular formula C11H11N3OS and a molecular weight of 233.30 g/mol. Its IUPAC name is 5-(4-cyclopropyloxyphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(4-cyclopropyloxyphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 114520379 |
| Molecular Formula | C11H11N3OS |
| Molecular Weight | 233.30 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | 5-(4-cyclopropyloxyphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Nc1nnc(-c2ccc(OC3CC3)cc2)s1 |
| InChI | InChI=1S/C11H11N3OS/c12-11-14-13-10(16-11)7-1-3-8(4-2-7)15-9-5-6-9/h1-4,9H,5-6H2,(H2,12,14) |
| InChIKey | OJMVUWVQYUWGMN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |