C22H22N2O3S — CID 20655660
methyl 4-[5-(4-cyclohexyloxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate (PubChem CID 20655660) has the molecular formula C22H22N2O3S and a molecular weight of 394.50 g/mol. Its IUPAC name is methyl 4-[5-(4-cyclohexyloxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate.
| Compound Name | methyl 4-[5-(4-cyclohexyloxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate |
|---|---|
| PubChem CID | 20655660 |
| Molecular Formula | C22H22N2O3S |
| Molecular Weight | 394.50 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | methyl 4-[5-(4-cyclohexyloxyphenyl)-1,3,4-thiadiazol-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2nnc(-c3ccc(OC4CCCCC4)cc3)s2)cc1 |
| InChI | InChI=1S/C22H22N2O3S/c1-26-22(25)17-9-7-15(8-10-17)20-23-24-21(28-20)16-11-13-19(14-12-16)27-18-5-3-2-4-6-18/h7-14,18H,2-6H2,1H3 |
| InChIKey | QPBWUCNQVNIWNU-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.50 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |