About bromo 4-cyclobutyloxybenzoate
bromo 4-cyclobutyloxybenzoate (PubChem CID 70345059) has the molecular formula C11H11BrO3
and a molecular weight of 271.11 g/mol. Its IUPAC name is bromo 4-cyclobutyloxybenzoate.
Molecular Properties
| Compound Name | bromo 4-cyclobutyloxybenzoate |
| PubChem CID | 70345059 |
| Molecular Formula | C11H11BrO3 |
| Molecular Weight | 271.11 g/mol |
| Exact Mass | 269.99 |
| IUPAC Name | bromo 4-cyclobutyloxybenzoate |
| SMILES | O=C(OBr)c1ccc(OC2CCC2)cc1 |
| InChI | InChI=1S/C11H11BrO3/c12-15-11(13)8-4-6-10(7-5-8)14-9-2-1-3-9/h4-7,9H,1-3H2 |
| InChIKey | QBPFQSGPKHCYFI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.11 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze bromo 4-cyclobutyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo 4-cyclobutyloxybenzoate?
The IUPAC name of bromo 4-cyclobutyloxybenzoate (CID 70345059) is bromo 4-cyclobutyloxybenzoate.
What is the SMILES notation for bromo 4-cyclobutyloxybenzoate?
The canonical SMILES for bromo 4-cyclobutyloxybenzoate is O=C(OBr)c1ccc(OC2CCC2)cc1.
What is the InChIKey of bromo 4-cyclobutyloxybenzoate?
The InChIKey is QBPFQSGPKHCYFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO3/c12-15-11(13)8-4-6-10(7-5-8)14-9-2-1-3-9/h4-7,9H,1-3H2.
What are the key properties of bromo 4-cyclobutyloxybenzoate?
bromo 4-cyclobutyloxybenzoate has a molecular weight of 271.11 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bromo 4-cyclobutyloxybenzoate is sourced from PubChem (CID 70345059), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).