C12H14N2OS — CID 82276097
2-methoxy-3-methyl-5-(2-methyl-1,3-thiazol-4-yl)aniline (PubChem CID 82276097) has the molecular formula C12H14N2OS and a molecular weight of 234.32 g/mol. Its IUPAC name is 2-methoxy-3-methyl-5-(2-methyl-1,3-thiazol-4-yl)aniline.
| Compound Name | 2-methoxy-3-methyl-5-(2-methyl-1,3-thiazol-4-yl)aniline |
|---|---|
| PubChem CID | 82276097 |
| Molecular Formula | C12H14N2OS |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.08 |
| IUPAC Name | 2-methoxy-3-methyl-5-(2-methyl-1,3-thiazol-4-yl)aniline |
| SMILES | COc1c(C)cc(-c2csc(C)n2)cc1N |
| InChI | InChI=1S/C12H14N2OS/c1-7-4-9(5-10(13)12(7)15-3)11-6-16-8(2)14-11/h4-6H,13H2,1-3H3 |
| InChIKey | PGQAWDGTENVBJP-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|