C10H9FN2S — CID 130835519
3-fluoro-5-(2-methyl-1,3-thiazol-4-yl)aniline (PubChem CID 130835519) has the molecular formula C10H9FN2S and a molecular weight of 208.26 g/mol. Its IUPAC name is 3-fluoro-5-(2-methyl-1,3-thiazol-4-yl)aniline.
| Compound Name | 3-fluoro-5-(2-methyl-1,3-thiazol-4-yl)aniline |
|---|---|
| PubChem CID | 130835519 |
| Molecular Formula | C10H9FN2S |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 3-fluoro-5-(2-methyl-1,3-thiazol-4-yl)aniline |
| SMILES | Cc1nc(-c2cc(N)cc(F)c2)cs1 |
| InChI | InChI=1S/C10H9FN2S/c1-6-13-10(5-14-6)7-2-8(11)4-9(12)3-7/h2-5H,12H2,1H3 |
| InChIKey | AMCNRMLUAUFVIT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|