C11H10F2N2S — CID 79016354
2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]ethanamine (PubChem CID 79016354) has the molecular formula C11H10F2N2S and a molecular weight of 240.28 g/mol. Its IUPAC name is 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]ethanamine.
| Compound Name | 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 79016354 |
| Molecular Formula | C11H10F2N2S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | 2-[4-(3,5-difluorophenyl)-1,3-thiazol-2-yl]ethanamine |
| SMILES | NCCc1nc(-c2cc(F)cc(F)c2)cs1 |
| InChI | InChI=1S/C11H10F2N2S/c12-8-3-7(4-9(13)5-8)10-6-16-11(15-10)1-2-14/h3-6H,1-2,14H2 |
| InChIKey | NPUSPHZQAGOUTG-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |