C11H10Br2N2S — CID 5207559
2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine (PubChem CID 5207559) has the molecular formula C11H10Br2N2S and a molecular weight of 362.09 g/mol. Its IUPAC name is 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine.
| Compound Name | 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 5207559 |
| Molecular Formula | C11H10Br2N2S |
| Molecular Weight | 362.09 g/mol |
| Exact Mass | 359.89 |
| IUPAC Name | 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine |
| SMILES | NCCc1nc(-c2cc(Br)ccc2Br)cs1 |
| InChI | InChI=1S/C11H10Br2N2S/c12-7-1-2-9(13)8(5-7)10-6-16-11(15-10)3-4-14/h1-2,5-6H,3-4,14H2 |
| InChIKey | MQXZWBMEGDTPQY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.09 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |