About 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine
2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine (PubChem CID 5207559) has the molecular formula C11H10Br2N2S
and a molecular weight of 362.09 g/mol. Its IUPAC name is 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine |
| PubChem CID | 5207559 |
| Molecular Formula | C11H10Br2N2S |
| Molecular Weight | 362.09 g/mol |
| Exact Mass | 359.89 |
| IUPAC Name | 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine |
| SMILES | NCCc1nc(-c2cc(Br)ccc2Br)cs1 |
| InChI | InChI=1S/C11H10Br2N2S/c12-7-1-2-9(13)8(5-7)10-6-16-11(15-10)3-4-14/h1-2,5-6H,3-4,14H2 |
| InChIKey | MQXZWBMEGDTPQY-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.09 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine?
The IUPAC name of 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine (CID 5207559) is 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine.
What is the SMILES notation for 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine?
The canonical SMILES for 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine is NCCc1nc(-c2cc(Br)ccc2Br)cs1.
What is the InChIKey of 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine?
The InChIKey is MQXZWBMEGDTPQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10Br2N2S/c12-7-1-2-9(13)8(5-7)10-6-16-11(15-10)3-4-14/h1-2,5-6H,3-4,14H2.
What are the key properties of 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine?
2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine has a molecular weight of 362.09 g/mol, XLogP of 3.84, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,5-dibromophenyl)-1,3-thiazol-2-yl]ethanamine is sourced from PubChem (CID 5207559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).