C13H14BrFN2S — CID 116965145
4-[4-(5-bromo-2-fluorophenyl)-1,3-thiazol-2-yl]butan-2-amine (PubChem CID 116965145) has the molecular formula C13H14BrFN2S and a molecular weight of 329.24 g/mol. Its IUPAC name is 4-[4-(5-bromo-2-fluorophenyl)-1,3-thiazol-2-yl]butan-2-amine.
| Compound Name | 4-[4-(5-bromo-2-fluorophenyl)-1,3-thiazol-2-yl]butan-2-amine |
|---|---|
| PubChem CID | 116965145 |
| Molecular Formula | C13H14BrFN2S |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 4-[4-(5-bromo-2-fluorophenyl)-1,3-thiazol-2-yl]butan-2-amine |
| SMILES | CC(N)CCc1nc(-c2cc(Br)ccc2F)cs1 |
| InChI | InChI=1S/C13H14BrFN2S/c1-8(16)2-5-13-17-12(7-18-13)10-6-9(14)3-4-11(10)15/h3-4,6-8H,2,5,16H2,1H3 |
| InChIKey | XIROYVQLRYKZKB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |