C10H9Br2N3O — CID 114375433
2-[5-(2,5-dibromophenyl)-1,3,4-oxadiazol-2-yl]ethanamine (PubChem CID 114375433) has the molecular formula C10H9Br2N3O and a molecular weight of 347.01 g/mol. Its IUPAC name is 2-[5-(2,5-dibromophenyl)-1,3,4-oxadiazol-2-yl]ethanamine.
| Compound Name | 2-[5-(2,5-dibromophenyl)-1,3,4-oxadiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 114375433 |
| Molecular Formula | C10H9Br2N3O |
| Molecular Weight | 347.01 g/mol |
| Exact Mass | 344.91 |
| IUPAC Name | 2-[5-(2,5-dibromophenyl)-1,3,4-oxadiazol-2-yl]ethanamine |
| SMILES | NCCc1nnc(-c2cc(Br)ccc2Br)o1 |
| InChI | InChI=1S/C10H9Br2N3O/c11-6-1-2-8(12)7(5-6)10-15-14-9(16-10)3-4-13/h1-2,5H,3-4,13H2 |
| InChIKey | RVFIERQWTZOAMK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.01 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |