C12H13BrClN3O — CID 55043927
2-[5-(5-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-ethylethanamine (PubChem CID 55043927) has the molecular formula C12H13BrClN3O and a molecular weight of 330.61 g/mol. Its IUPAC name is 2-[5-(5-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-ethylethanamine.
| Compound Name | 2-[5-(5-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 55043927 |
| Molecular Formula | C12H13BrClN3O |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 2-[5-(5-bromo-2-chlorophenyl)-1,3,4-oxadiazol-2-yl]-N-ethylethanamine |
| SMILES | CCNCCc1nnc(-c2cc(Br)ccc2Cl)o1 |
| InChI | InChI=1S/C12H13BrClN3O/c1-2-15-6-5-11-16-17-12(18-11)9-7-8(13)3-4-10(9)14/h3-4,7,15H,2,5-6H2,1H3 |
| InChIKey | NUULREMRUHKXOG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|