C13H16ClN3O — CID 82891184
2-[5-(5-chloro-2-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-ethylethanamine (PubChem CID 82891184) has the molecular formula C13H16ClN3O and a molecular weight of 265.74 g/mol. Its IUPAC name is 2-[5-(5-chloro-2-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-ethylethanamine.
| Compound Name | 2-[5-(5-chloro-2-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-ethylethanamine |
|---|---|
| PubChem CID | 82891184 |
| Molecular Formula | C13H16ClN3O |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 2-[5-(5-chloro-2-methylphenyl)-1,3,4-oxadiazol-2-yl]-N-ethylethanamine |
| SMILES | CCNCCc1nnc(-c2cc(Cl)ccc2C)o1 |
| InChI | InChI=1S/C13H16ClN3O/c1-3-15-7-6-12-16-17-13(18-12)11-8-10(14)5-4-9(11)2/h4-5,8,15H,3,6-7H2,1-2H3 |
| InChIKey | KMCHYYVLIFWTAI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|