C10H11N3O2S — CID 3407778
5-(2,6-dimethoxyphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 3407778) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 5-(2,6-dimethoxyphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2,6-dimethoxyphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 3407778 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 5-(2,6-dimethoxyphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | COc1cccc(OC)c1-c1nnc(N)s1 |
| InChI | InChI=1S/C10H11N3O2S/c1-14-6-4-3-5-7(15-2)8(6)9-12-13-10(11)16-9/h3-5H,1-2H3,(H2,11,13) |
| InChIKey | LVVJKSCZUBZUOF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |