C10H8N4OS — CID 106951468
3-(5-amino-1,3,4-thiadiazol-2-yl)-4-methoxybenzonitrile (PubChem CID 106951468) has the molecular formula C10H8N4OS and a molecular weight of 232.27 g/mol. Its IUPAC name is 3-(5-amino-1,3,4-thiadiazol-2-yl)-4-methoxybenzonitrile.
| Compound Name | 3-(5-amino-1,3,4-thiadiazol-2-yl)-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 106951468 |
| Molecular Formula | C10H8N4OS |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | 3-(5-amino-1,3,4-thiadiazol-2-yl)-4-methoxybenzonitrile |
| SMILES | COc1ccc(C#N)cc1-c1nnc(N)s1 |
| InChI | InChI=1S/C10H8N4OS/c1-15-8-3-2-6(5-11)4-7(8)9-13-14-10(12)16-9/h2-4H,1H3,(H2,12,14) |
| InChIKey | JQGUTPIDLQCJNK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |