C30H21N5OS — CID 162788027
5-[2-methoxy-5-[4-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl]phenyl]-1,3,4-thiadiazol-2-amine (PubChem CID 162788027) has the molecular formula C30H21N5OS and a molecular weight of 499.60 g/mol. Its IUPAC name is 5-[2-methoxy-5-[4-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl]phenyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-methoxy-5-[4-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl]phenyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 162788027 |
| Molecular Formula | C30H21N5OS |
| Molecular Weight | 499.60 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | 5-[2-methoxy-5-[4-(1H-phenanthro[9,10-d]imidazol-2-yl)phenyl]phenyl]-1,3,4-thiadiazol-2-amine |
| SMILES | COc1ccc(-c2ccc(-c3nc4c5ccccc5c5ccccc5c4[nH]3)cc2)cc1-c1nnc(N)s1 |
| InChI | InChI=1S/C30H21N5OS/c1-36-25-15-14-19(16-24(25)29-34-35-30(31)37-29)17-10-12-18(13-11-17)28-32-26-22-8-4-2-6-20(22)21-7-3-5-9-23(21)27(26)33-28/h2-16H,1H3,(H2,31,35)(H,32,33) |
| InChIKey | JOJOPCFWOYLBAW-UHFFFAOYSA-N |
| XLogP | 7.31 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.60 |
| LogP ≤ 5 | 7.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|