C9H8IN3S — CID 103863145
5-(2-iodo-3-methylphenyl)-1,3,4-thiadiazol-2-amine (PubChem CID 103863145) has the molecular formula C9H8IN3S and a molecular weight of 317.16 g/mol. Its IUPAC name is 5-(2-iodo-3-methylphenyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(2-iodo-3-methylphenyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 103863145 |
| Molecular Formula | C9H8IN3S |
| Molecular Weight | 317.16 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 5-(2-iodo-3-methylphenyl)-1,3,4-thiadiazol-2-amine |
| SMILES | Cc1cccc(-c2nnc(N)s2)c1I |
| InChI | InChI=1S/C9H8IN3S/c1-5-3-2-4-6(7(5)10)8-12-13-9(11)14-8/h2-4H,1H3,(H2,11,13) |
| InChIKey | WHPQAMIIHGPSQP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.16 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|