C11H13N3OS — CID 6486679
5-[2-(2-methoxyphenyl)ethyl]-1,3,4-thiadiazol-2-amine (PubChem CID 6486679) has the molecular formula C11H13N3OS and a molecular weight of 235.31 g/mol. Its IUPAC name is 5-[2-(2-methoxyphenyl)ethyl]-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-[2-(2-methoxyphenyl)ethyl]-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 6486679 |
| Molecular Formula | C11H13N3OS |
| Molecular Weight | 235.31 g/mol |
| Exact Mass | 235.08 |
| IUPAC Name | 5-[2-(2-methoxyphenyl)ethyl]-1,3,4-thiadiazol-2-amine |
| SMILES | COc1ccccc1CCc1nnc(N)s1 |
| InChI | InChI=1S/C11H13N3OS/c1-15-9-5-3-2-4-8(9)6-7-10-13-14-11(12)16-10/h2-5H,6-7H2,1H3,(H2,12,14) |
| InChIKey | JQSSGPFBXKIZDK-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.31 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |