C12H17N5O — CID 35754981
[5-[2-(2-methoxyphenyl)ethyl]-4-methyl-1,2,4-triazol-3-yl]hydrazine (PubChem CID 35754981) has the molecular formula C12H17N5O and a molecular weight of 247.30 g/mol. Its IUPAC name is [5-[2-(2-methoxyphenyl)ethyl]-4-methyl-1,2,4-triazol-3-yl]hydrazine.
| Compound Name | [5-[2-(2-methoxyphenyl)ethyl]-4-methyl-1,2,4-triazol-3-yl]hydrazine |
|---|---|
| PubChem CID | 35754981 |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | [5-[2-(2-methoxyphenyl)ethyl]-4-methyl-1,2,4-triazol-3-yl]hydrazine |
| SMILES | COc1ccccc1CCc1nnc(NN)n1C |
| InChI | InChI=1S/C12H17N5O/c1-17-11(15-16-12(17)14-13)8-7-9-5-3-4-6-10(9)18-2/h3-6H,7-8,13H2,1-2H3,(H,14,16) |
| InChIKey | PFALIAFMHSQAON-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|