C12H10N2O4S — CID 2746991
1-[2-(4-methoxy-3-nitrophenyl)-1,3-thiazol-4-yl]ethanone (PubChem CID 2746991) has the molecular formula C12H10N2O4S and a molecular weight of 278.29 g/mol. Its IUPAC name is 1-[2-(4-methoxy-3-nitrophenyl)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(4-methoxy-3-nitrophenyl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 2746991 |
| Molecular Formula | C12H10N2O4S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | 1-[2-(4-methoxy-3-nitrophenyl)-1,3-thiazol-4-yl]ethanone |
| SMILES | COc1ccc(-c2nc(C(C)=O)cs2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H10N2O4S/c1-7(15)9-6-19-12(13-9)8-3-4-11(18-2)10(5-8)14(16)17/h3-6H,1-2H3 |
| InChIKey | NNVLCSJRIVQWFH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|