C12H12N2O2S2 — CID 82515938
2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carbothioamide (PubChem CID 82515938) has the molecular formula C12H12N2O2S2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carbothioamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carbothioamide |
|---|---|
| PubChem CID | 82515938 |
| Molecular Formula | C12H12N2O2S2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-1,3-thiazole-4-carbothioamide |
| SMILES | COc1ccc(-c2nc(C(N)=S)cs2)cc1OC |
| InChI | InChI=1S/C12H12N2O2S2/c1-15-9-4-3-7(5-10(9)16-2)12-14-8(6-18-12)11(13)17/h3-6H,1-2H3,(H2,13,17) |
| InChIKey | RCTCQCMQNVJQNG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|